C40H44N2O8 — CID 66673234
bis[(2R)-2-amino-2-methyl-4-[5-(4-phenoxybut-1-ynyl)furan-2-yl]butyl] oxalate (PubChem CID 66673234) has the molecular formula C40H44N2O8 and a molecular weight of 680.80 g/mol. Its IUPAC name is bis[(2R)-2-amino-2-methyl-4-[5-(4-phenoxybut-1-ynyl)furan-2-yl]butyl] oxalate.
| Compound Name | bis[(2R)-2-amino-2-methyl-4-[5-(4-phenoxybut-1-ynyl)furan-2-yl]butyl] oxalate |
|---|---|
| PubChem CID | 66673234 |
| Molecular Formula | C40H44N2O8 |
| Molecular Weight | 680.80 g/mol |
| Exact Mass | 680.31 |
| IUPAC Name | bis[(2R)-2-amino-2-methyl-4-[5-(4-phenoxybut-1-ynyl)furan-2-yl]butyl] oxalate |
| SMILES | C[C@@](N)(CCc1ccc(C#CCCOc2ccccc2)o1)COC(=O)C(=O)OC[C@](C)(N)CCc1ccc(C#CCCOc2ccccc2)o1 |
| InChI | InChI=1S/C40H44N2O8/c1-39(41,25-23-35-21-19-33(49-35)17-9-11-27-45-31-13-5-3-6-14-31)29-47-37(43)38(44)48-30-40(2,42)26-24-36-22-20-34(50-36)18-10-12-28-46-32-15-7-4-8-16-32/h3-8,13-16,19-22H,11-12,23-30,41-42H2,1-2H3/t39-,40-/m1/s1 |
| InChIKey | DESLGKHAQLWKHJ-XRSDMRJBSA-N |
| XLogP | 5.60 |
| TPSA | 149.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.80 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|