C19H20F3NO3 — CID 18448094
(2R)-2-amino-2-methyl-4-[5-[3-[3-(trifluoromethyl)phenoxy]prop-1-ynyl]furan-2-yl]butan-1-ol (PubChem CID 18448094) has the molecular formula C19H20F3NO3 and a molecular weight of 367.37 g/mol. Its IUPAC name is (2R)-2-amino-2-methyl-4-[5-[3-[3-(trifluoromethyl)phenoxy]prop-1-ynyl]furan-2-yl]butan-1-ol.
| Compound Name | (2R)-2-amino-2-methyl-4-[5-[3-[3-(trifluoromethyl)phenoxy]prop-1-ynyl]furan-2-yl]butan-1-ol |
|---|---|
| PubChem CID | 18448094 |
| Molecular Formula | C19H20F3NO3 |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | (2R)-2-amino-2-methyl-4-[5-[3-[3-(trifluoromethyl)phenoxy]prop-1-ynyl]furan-2-yl]butan-1-ol |
| SMILES | C[C@](N)(CO)CCc1ccc(C#CCOc2cccc(C(F)(F)F)c2)o1 |
| InChI | InChI=1S/C19H20F3NO3/c1-18(23,13-24)10-9-16-8-7-15(26-16)6-3-11-25-17-5-2-4-14(12-17)19(20,21)22/h2,4-5,7-8,12,24H,9-11,13,23H2,1H3/t18-/m1/s1 |
| InChIKey | DVBXRISQDDUCFA-GOSISDBHSA-N |
| XLogP | 3.37 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|