C22H27NO6 — CID 90923704
2-[(2R)-2-amino-2-methyl-4-[5-(5-phenylpentanoyl)furan-2-yl]butoxy]-2-oxoacetic acid (PubChem CID 90923704) has the molecular formula C22H27NO6 and a molecular weight of 401.46 g/mol. Its IUPAC name is 2-[(2R)-2-amino-2-methyl-4-[5-(5-phenylpentanoyl)furan-2-yl]butoxy]-2-oxoacetic acid.
| Compound Name | 2-[(2R)-2-amino-2-methyl-4-[5-(5-phenylpentanoyl)furan-2-yl]butoxy]-2-oxoacetic acid |
|---|---|
| PubChem CID | 90923704 |
| Molecular Formula | C22H27NO6 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 2-[(2R)-2-amino-2-methyl-4-[5-(5-phenylpentanoyl)furan-2-yl]butoxy]-2-oxoacetic acid |
| SMILES | C[C@@](N)(CCc1ccc(C(=O)CCCCc2ccccc2)o1)COC(=O)C(=O)O |
| InChI | InChI=1S/C22H27NO6/c1-22(23,15-28-21(27)20(25)26)14-13-17-11-12-19(29-17)18(24)10-6-5-9-16-7-3-2-4-8-16/h2-4,7-8,11-12H,5-6,9-10,13-15,23H2,1H3,(H,25,26)/t22-/m1/s1 |
| InChIKey | YLAIBZINZZKWCN-JOCHJYFZSA-N |
| XLogP | 3.15 |
| TPSA | 119.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|