C40H52N2O8S2 — CID 69337661
bis[(2R)-2-amino-2-methyl-4-[5-(3-phenylpropoxy)thiophen-2-yl]butyl] 2,3-dihydroxybutanedioate (PubChem CID 69337661) has the molecular formula C40H52N2O8S2 and a molecular weight of 753.00 g/mol. Its IUPAC name is bis[(2R)-2-amino-2-methyl-4-[5-(3-phenylpropoxy)thiophen-2-yl]butyl] 2,3-dihydroxybutanedioate.
| Compound Name | bis[(2R)-2-amino-2-methyl-4-[5-(3-phenylpropoxy)thiophen-2-yl]butyl] 2,3-dihydroxybutanedioate |
|---|---|
| PubChem CID | 69337661 |
| Molecular Formula | C40H52N2O8S2 |
| Molecular Weight | 753.00 g/mol |
| Exact Mass | 752.32 |
| IUPAC Name | bis[(2R)-2-amino-2-methyl-4-[5-(3-phenylpropoxy)thiophen-2-yl]butyl] 2,3-dihydroxybutanedioate |
| SMILES | C[C@@](N)(CCc1ccc(OCCCc2ccccc2)s1)COC(=O)C(O)C(O)C(=O)OC[C@](C)(N)CCc1ccc(OCCCc2ccccc2)s1 |
| InChI | InChI=1S/C40H52N2O8S2/c1-39(41,23-21-31-17-19-33(51-31)47-25-9-15-29-11-5-3-6-12-29)27-49-37(45)35(43)36(44)38(46)50-28-40(2,42)24-22-32-18-20-34(52-32)48-26-10-16-30-13-7-4-8-14-30/h3-8,11-14,17-20,35-36,43-44H,9-10,15-16,21-28,41-42H2,1-2H3/t35?,36?,39-,40-/m1/s1 |
| InChIKey | ACZYPEKJEDNQNU-PKLFNNNWSA-N |
| XLogP | 5.64 |
| TPSA | 163.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.00 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|