C24H33NO6S — CID 69338414
(2R)-1-amino-2-methyl-4-[5-(4-phenylmethoxybutyl)thiophen-2-yl]butan-1-ol;(Z)-but-2-enedioic acid (PubChem CID 69338414) has the molecular formula C24H33NO6S and a molecular weight of 463.60 g/mol. Its IUPAC name is (2R)-1-amino-2-methyl-4-[5-(4-phenylmethoxybutyl)thiophen-2-yl]butan-1-ol;(Z)-but-2-enedioic acid.
| Compound Name | (2R)-1-amino-2-methyl-4-[5-(4-phenylmethoxybutyl)thiophen-2-yl]butan-1-ol;(Z)-but-2-enedioic acid |
|---|---|
| PubChem CID | 69338414 |
| Molecular Formula | C24H33NO6S |
| Molecular Weight | 463.60 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | (2R)-1-amino-2-methyl-4-[5-(4-phenylmethoxybutyl)thiophen-2-yl]butan-1-ol;(Z)-but-2-enedioic acid |
| SMILES | C[C@H](CCc1ccc(CCCCOCc2ccccc2)s1)C(N)O.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C20H29NO2S.C4H4O4/c1-16(20(21)22)10-11-19-13-12-18(24-19)9-5-6-14-23-15-17-7-3-2-4-8-17;5-3(6)1-2-4(7)8/h2-4,7-8,12-13,16,20,22H,5-6,9-11,14-15,21H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1-/t16-,20?;/m1./s1 |
| InChIKey | LGAUBCCWMUXHPB-IJVPQHCHSA-N |
| XLogP | 3.85 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.60 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|