C14H15ClOS — CID 65149922
1-(5-chlorothiophen-2-yl)-4-phenylbutan-1-ol (PubChem CID 65149922) has the molecular formula C14H15ClOS and a molecular weight of 266.79 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)-4-phenylbutan-1-ol.
| Compound Name | 1-(5-chlorothiophen-2-yl)-4-phenylbutan-1-ol |
|---|---|
| PubChem CID | 65149922 |
| Molecular Formula | C14H15ClOS |
| Molecular Weight | 266.79 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)-4-phenylbutan-1-ol |
| SMILES | OC(CCCc1ccccc1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C14H15ClOS/c15-14-10-9-13(17-14)12(16)8-4-7-11-5-2-1-3-6-11/h1-3,5-6,9-10,12,16H,4,7-8H2 |
| InChIKey | SPFSLMFTYYUAHW-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.79 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |