C12H13ClOS2 — CID 105119774
1-(5-chlorothiophen-2-yl)-4-thiophen-2-ylbutan-1-ol (PubChem CID 105119774) has the molecular formula C12H13ClOS2 and a molecular weight of 272.82 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)-4-thiophen-2-ylbutan-1-ol.
| Compound Name | 1-(5-chlorothiophen-2-yl)-4-thiophen-2-ylbutan-1-ol |
|---|---|
| PubChem CID | 105119774 |
| Molecular Formula | C12H13ClOS2 |
| Molecular Weight | 272.82 g/mol |
| Exact Mass | 272.01 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)-4-thiophen-2-ylbutan-1-ol |
| SMILES | OC(CCCc1cccs1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C12H13ClOS2/c13-12-7-6-11(16-12)10(14)5-1-3-9-4-2-8-15-9/h2,4,6-8,10,14H,1,3,5H2 |
| InChIKey | USUWAGMVTXCDFD-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.82 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |