C13H16OS2 — CID 65150040
1-(5-ethylthiophen-2-yl)-3-thiophen-2-ylpropan-1-ol (PubChem CID 65150040) has the molecular formula C13H16OS2 and a molecular weight of 252.40 g/mol. Its IUPAC name is 1-(5-ethylthiophen-2-yl)-3-thiophen-2-ylpropan-1-ol.
| Compound Name | 1-(5-ethylthiophen-2-yl)-3-thiophen-2-ylpropan-1-ol |
|---|---|
| PubChem CID | 65150040 |
| Molecular Formula | C13H16OS2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 1-(5-ethylthiophen-2-yl)-3-thiophen-2-ylpropan-1-ol |
| SMILES | CCc1ccc(C(O)CCc2cccs2)s1 |
| InChI | InChI=1S/C13H16OS2/c1-2-10-6-8-13(16-10)12(14)7-5-11-4-3-9-15-11/h3-4,6,8-9,12,14H,2,5,7H2,1H3 |
| InChIKey | DBVLSWQBBASGSR-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |