C12H20O2S — CID 103457143
5,5-dimethyl-1-thiophen-2-ylhexane-3,4-diol (PubChem CID 103457143) has the molecular formula C12H20O2S and a molecular weight of 228.36 g/mol. Its IUPAC name is 5,5-dimethyl-1-thiophen-2-ylhexane-3,4-diol.
| Compound Name | 5,5-dimethyl-1-thiophen-2-ylhexane-3,4-diol |
|---|---|
| PubChem CID | 103457143 |
| Molecular Formula | C12H20O2S |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 5,5-dimethyl-1-thiophen-2-ylhexane-3,4-diol |
| SMILES | CC(C)(C)C(O)C(O)CCc1cccs1 |
| InChI | InChI=1S/C12H20O2S/c1-12(2,3)11(14)10(13)7-6-9-5-4-8-15-9/h4-5,8,10-11,13-14H,6-7H2,1-3H3 |
| InChIKey | GVCPSIWILGUFAW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |