C14H24OS — CID 115800483
5,6,6-trimethyl-1-thiophen-2-ylheptan-3-ol (PubChem CID 115800483) has the molecular formula C14H24OS and a molecular weight of 240.41 g/mol. Its IUPAC name is 5,6,6-trimethyl-1-thiophen-2-ylheptan-3-ol.
| Compound Name | 5,6,6-trimethyl-1-thiophen-2-ylheptan-3-ol |
|---|---|
| PubChem CID | 115800483 |
| Molecular Formula | C14H24OS |
| Molecular Weight | 240.41 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 5,6,6-trimethyl-1-thiophen-2-ylheptan-3-ol |
| SMILES | CC(CC(O)CCc1cccs1)C(C)(C)C |
| InChI | InChI=1S/C14H24OS/c1-11(14(2,3)4)10-12(15)7-8-13-6-5-9-16-13/h5-6,9,11-12,15H,7-8,10H2,1-4H3 |
| InChIKey | RCELPOUFZDRKJV-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.41 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |