C29H35F3N2O5 — CID 163684987
8-[[(2R)-2-[[(2S)-2-benzyl-5,5,5-trifluoro-4-oxopentanoyl]amino]-3-phenylpropanoyl]amino]octanoic acid (PubChem CID 163684987) has the molecular formula C29H35F3N2O5 and a molecular weight of 548.60 g/mol. Its IUPAC name is 8-[[(2R)-2-[[(2S)-2-benzyl-5,5,5-trifluoro-4-oxopentanoyl]amino]-3-phenylpropanoyl]amino]octanoic acid.
| Compound Name | 8-[[(2R)-2-[[(2S)-2-benzyl-5,5,5-trifluoro-4-oxopentanoyl]amino]-3-phenylpropanoyl]amino]octanoic acid |
|---|---|
| PubChem CID | 163684987 |
| Molecular Formula | C29H35F3N2O5 |
| Molecular Weight | 548.60 g/mol |
| Exact Mass | 548.25 |
| IUPAC Name | 8-[[(2R)-2-[[(2S)-2-benzyl-5,5,5-trifluoro-4-oxopentanoyl]amino]-3-phenylpropanoyl]amino]octanoic acid |
| SMILES | O=C(O)CCCCCCCNC(=O)[C@@H](Cc1ccccc1)NC(=O)[C@H](CC(=O)C(F)(F)F)Cc1ccccc1 |
| InChI | InChI=1S/C29H35F3N2O5/c30-29(31,32)25(35)20-23(18-21-12-6-4-7-13-21)27(38)34-24(19-22-14-8-5-9-15-22)28(39)33-17-11-3-1-2-10-16-26(36)37/h4-9,12-15,23-24H,1-3,10-11,16-20H2,(H,33,39)(H,34,38)(H,36,37)/t23-,24+/m0/s1 |
| InChIKey | JOBRMHRPBQETQT-BJKOFHAPSA-N |
| XLogP | 4.64 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.60 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|