C18H21NO4S — CID 122099745
2-[2-(1,2-diphenylethylamino)ethylsulfonyl]acetic acid (PubChem CID 122099745) has the molecular formula C18H21NO4S and a molecular weight of 347.44 g/mol. Its IUPAC name is 2-[2-(1,2-diphenylethylamino)ethylsulfonyl]acetic acid.
| Compound Name | 2-[2-(1,2-diphenylethylamino)ethylsulfonyl]acetic acid |
|---|---|
| PubChem CID | 122099745 |
| Molecular Formula | C18H21NO4S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 2-[2-(1,2-diphenylethylamino)ethylsulfonyl]acetic acid |
| SMILES | O=C(O)CS(=O)(=O)CCNC(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H21NO4S/c20-18(21)14-24(22,23)12-11-19-17(16-9-5-2-6-10-16)13-15-7-3-1-4-8-15/h1-10,17,19H,11-14H2,(H,20,21) |
| InChIKey | BQLLNUJGYMITLG-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |