C23H22F2N2O3S — CID 55469182
N-[4-(difluoromethylsulfonyl)phenyl]-2-(1,2-diphenylethylamino)acetamide (PubChem CID 55469182) has the molecular formula C23H22F2N2O3S and a molecular weight of 444.50 g/mol. Its IUPAC name is N-[4-(difluoromethylsulfonyl)phenyl]-2-(1,2-diphenylethylamino)acetamide.
| Compound Name | N-[4-(difluoromethylsulfonyl)phenyl]-2-(1,2-diphenylethylamino)acetamide |
|---|---|
| PubChem CID | 55469182 |
| Molecular Formula | C23H22F2N2O3S |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | N-[4-(difluoromethylsulfonyl)phenyl]-2-(1,2-diphenylethylamino)acetamide |
| SMILES | O=C(CNC(Cc1ccccc1)c1ccccc1)Nc1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C23H22F2N2O3S/c24-23(25)31(29,30)20-13-11-19(12-14-20)27-22(28)16-26-21(18-9-5-2-6-10-18)15-17-7-3-1-4-8-17/h1-14,21,23,26H,15-16H2,(H,27,28) |
| InChIKey | KMYMUCXLPKAETB-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.50 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |