C19H25NO — CID 115720401
1-(1,2-diphenylethylamino)-3-methylbutan-2-ol (PubChem CID 115720401) has the molecular formula C19H25NO and a molecular weight of 283.42 g/mol. Its IUPAC name is 1-(1,2-diphenylethylamino)-3-methylbutan-2-ol.
| Compound Name | 1-(1,2-diphenylethylamino)-3-methylbutan-2-ol |
|---|---|
| PubChem CID | 115720401 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | 1-(1,2-diphenylethylamino)-3-methylbutan-2-ol |
| SMILES | CC(C)C(O)CNC(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H25NO/c1-15(2)19(21)14-20-18(17-11-7-4-8-12-17)13-16-9-5-3-6-10-16/h3-12,15,18-21H,13-14H2,1-2H3 |
| InChIKey | LREUHIYEMVCJAR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |