C15H24ClNO2S2 — CID 66147486
1-(3-chlorophenyl)sulfanyl-5-methylsulfonyl-N-propylpentan-2-amine (PubChem CID 66147486) has the molecular formula C15H24ClNO2S2 and a molecular weight of 349.95 g/mol. Its IUPAC name is 1-(3-chlorophenyl)sulfanyl-5-methylsulfonyl-N-propylpentan-2-amine.
| Compound Name | 1-(3-chlorophenyl)sulfanyl-5-methylsulfonyl-N-propylpentan-2-amine |
|---|---|
| PubChem CID | 66147486 |
| Molecular Formula | C15H24ClNO2S2 |
| Molecular Weight | 349.95 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 1-(3-chlorophenyl)sulfanyl-5-methylsulfonyl-N-propylpentan-2-amine |
| SMILES | CCCNC(CCCS(C)(=O)=O)CSc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H24ClNO2S2/c1-3-9-17-14(7-5-10-21(2,18)19)12-20-15-8-4-6-13(16)11-15/h4,6,8,11,14,17H,3,5,7,9-10,12H2,1-2H3 |
| InChIKey | JPEKGACZPAWILL-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.95 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |