C12H18ClNO2S2 — CID 66146207
1-(3-chlorophenyl)sulfanyl-5-methylsulfonylpentan-2-amine (PubChem CID 66146207) has the molecular formula C12H18ClNO2S2 and a molecular weight of 307.87 g/mol. Its IUPAC name is 1-(3-chlorophenyl)sulfanyl-5-methylsulfonylpentan-2-amine.
| Compound Name | 1-(3-chlorophenyl)sulfanyl-5-methylsulfonylpentan-2-amine |
|---|---|
| PubChem CID | 66146207 |
| Molecular Formula | C12H18ClNO2S2 |
| Molecular Weight | 307.87 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 1-(3-chlorophenyl)sulfanyl-5-methylsulfonylpentan-2-amine |
| SMILES | CS(=O)(=O)CCCC(N)CSc1cccc(Cl)c1 |
| InChI | InChI=1S/C12H18ClNO2S2/c1-18(15,16)7-3-5-11(14)9-17-12-6-2-4-10(13)8-12/h2,4,6,8,11H,3,5,7,9,14H2,1H3 |
| InChIKey | WQFSHSCCFNGXGG-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.87 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |