C13H21NO2S2 — CID 66099255
1-(2-methylphenyl)sulfanyl-5-methylsulfonylpentan-2-amine (PubChem CID 66099255) has the molecular formula C13H21NO2S2 and a molecular weight of 287.45 g/mol. Its IUPAC name is 1-(2-methylphenyl)sulfanyl-5-methylsulfonylpentan-2-amine.
| Compound Name | 1-(2-methylphenyl)sulfanyl-5-methylsulfonylpentan-2-amine |
|---|---|
| PubChem CID | 66099255 |
| Molecular Formula | C13H21NO2S2 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 1-(2-methylphenyl)sulfanyl-5-methylsulfonylpentan-2-amine |
| SMILES | Cc1ccccc1SCC(N)CCCS(C)(=O)=O |
| InChI | InChI=1S/C13H21NO2S2/c1-11-6-3-4-8-13(11)17-10-12(14)7-5-9-18(2,15)16/h3-4,6,8,12H,5,7,9-10,14H2,1-2H3 |
| InChIKey | HCNAGDIVAYWXTF-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |