C12H14ClNS — CID 66148918
1-(3-chlorophenyl)sulfanylhex-5-yn-2-amine (PubChem CID 66148918) has the molecular formula C12H14ClNS and a molecular weight of 239.77 g/mol. Its IUPAC name is 1-(3-chlorophenyl)sulfanylhex-5-yn-2-amine.
| Compound Name | 1-(3-chlorophenyl)sulfanylhex-5-yn-2-amine |
|---|---|
| PubChem CID | 66148918 |
| Molecular Formula | C12H14ClNS |
| Molecular Weight | 239.77 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | 1-(3-chlorophenyl)sulfanylhex-5-yn-2-amine |
| SMILES | C#CCCC(N)CSc1cccc(Cl)c1 |
| InChI | InChI=1S/C12H14ClNS/c1-2-3-6-11(14)9-15-12-7-4-5-10(13)8-12/h1,4-5,7-8,11H,3,6,9,14H2 |
| InChIKey | ONLJMHLHKMWQPT-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.77 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|