C14H16ClN3S — CID 66146419
4-[2-amino-3-(3-chlorophenyl)sulfanylpropyl]pyridin-2-amine (PubChem CID 66146419) has the molecular formula C14H16ClN3S and a molecular weight of 293.82 g/mol. Its IUPAC name is 4-[2-amino-3-(3-chlorophenyl)sulfanylpropyl]pyridin-2-amine.
| Compound Name | 4-[2-amino-3-(3-chlorophenyl)sulfanylpropyl]pyridin-2-amine |
|---|---|
| PubChem CID | 66146419 |
| Molecular Formula | C14H16ClN3S |
| Molecular Weight | 293.82 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 4-[2-amino-3-(3-chlorophenyl)sulfanylpropyl]pyridin-2-amine |
| SMILES | Nc1cc(CC(N)CSc2cccc(Cl)c2)ccn1 |
| InChI | InChI=1S/C14H16ClN3S/c15-11-2-1-3-13(8-11)19-9-12(16)6-10-4-5-18-14(17)7-10/h1-5,7-8,12H,6,9,16H2,(H2,17,18) |
| InChIKey | JTIWBYIJXSTSLR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.82 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |