C15H19Cl2N3S — CID 66145999
1-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-3-(3-chlorophenyl)sulfanylpropan-2-amine (PubChem CID 66145999) has the molecular formula C15H19Cl2N3S and a molecular weight of 344.31 g/mol. Its IUPAC name is 1-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-3-(3-chlorophenyl)sulfanylpropan-2-amine.
| Compound Name | 1-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-3-(3-chlorophenyl)sulfanylpropan-2-amine |
|---|---|
| PubChem CID | 66145999 |
| Molecular Formula | C15H19Cl2N3S |
| Molecular Weight | 344.31 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | 1-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-3-(3-chlorophenyl)sulfanylpropan-2-amine |
| SMILES | CCc1nn(C)c(CC(N)CSc2cccc(Cl)c2)c1Cl |
| InChI | InChI=1S/C15H19Cl2N3S/c1-3-13-15(17)14(20(2)19-13)8-11(18)9-21-12-6-4-5-10(16)7-12/h4-7,11H,3,8-9,18H2,1-2H3 |
| InChIKey | BPSJGGCVGUEXNR-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.31 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |