C15H18ClFN2OS — CID 66071376
1-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-3-(4-fluorophenyl)sulfanylpropan-2-ol (PubChem CID 66071376) has the molecular formula C15H18ClFN2OS and a molecular weight of 328.84 g/mol. Its IUPAC name is 1-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-3-(4-fluorophenyl)sulfanylpropan-2-ol.
| Compound Name | 1-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-3-(4-fluorophenyl)sulfanylpropan-2-ol |
|---|---|
| PubChem CID | 66071376 |
| Molecular Formula | C15H18ClFN2OS |
| Molecular Weight | 328.84 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 1-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-3-(4-fluorophenyl)sulfanylpropan-2-ol |
| SMILES | CCc1nn(C)c(CC(O)CSc2ccc(F)cc2)c1Cl |
| InChI | InChI=1S/C15H18ClFN2OS/c1-3-13-15(16)14(19(2)18-13)8-11(20)9-21-12-6-4-10(17)5-7-12/h4-7,11,20H,3,8-9H2,1-2H3 |
| InChIKey | QSFMQWZHIJPAHP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.84 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |