C12H13Cl2N — CID 114977066
1-(2,6-dichlorophenyl)-N-ethylbut-3-yn-1-amine (PubChem CID 114977066) has the molecular formula C12H13Cl2N and a molecular weight of 242.15 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-N-ethylbut-3-yn-1-amine.
| Compound Name | 1-(2,6-dichlorophenyl)-N-ethylbut-3-yn-1-amine |
|---|---|
| PubChem CID | 114977066 |
| Molecular Formula | C12H13Cl2N |
| Molecular Weight | 242.15 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-N-ethylbut-3-yn-1-amine |
| SMILES | C#CCC(NCC)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H13Cl2N/c1-3-6-11(15-4-2)12-9(13)7-5-8-10(12)14/h1,5,7-8,11,15H,4,6H2,2H3 |
| InChIKey | FCPLXEOPYFYHNN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.15 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|