C12H10F5N — CID 114977670
N-ethyl-1-(2,3,4,5,6-pentafluorophenyl)but-3-yn-1-amine (PubChem CID 114977670) has the molecular formula C12H10F5N and a molecular weight of 263.21 g/mol. Its IUPAC name is N-ethyl-1-(2,3,4,5,6-pentafluorophenyl)but-3-yn-1-amine.
| Compound Name | N-ethyl-1-(2,3,4,5,6-pentafluorophenyl)but-3-yn-1-amine |
|---|---|
| PubChem CID | 114977670 |
| Molecular Formula | C12H10F5N |
| Molecular Weight | 263.21 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | N-ethyl-1-(2,3,4,5,6-pentafluorophenyl)but-3-yn-1-amine |
| SMILES | C#CCC(NCC)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H10F5N/c1-3-5-6(18-4-2)7-8(13)10(15)12(17)11(16)9(7)14/h1,6,18H,4-5H2,2H3 |
| InChIKey | QTRDMVIKOBLIEA-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.21 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|