C14H16F5N — CID 105039596
N-ethyl-4-methyl-1-(2,3,4,5,6-pentafluorophenyl)pent-4-en-1-amine (PubChem CID 105039596) has the molecular formula C14H16F5N and a molecular weight of 293.28 g/mol. Its IUPAC name is N-ethyl-4-methyl-1-(2,3,4,5,6-pentafluorophenyl)pent-4-en-1-amine.
| Compound Name | N-ethyl-4-methyl-1-(2,3,4,5,6-pentafluorophenyl)pent-4-en-1-amine |
|---|---|
| PubChem CID | 105039596 |
| Molecular Formula | C14H16F5N |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | N-ethyl-4-methyl-1-(2,3,4,5,6-pentafluorophenyl)pent-4-en-1-amine |
| SMILES | C=C(C)CCC(NCC)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C14H16F5N/c1-4-20-8(6-5-7(2)3)9-10(15)12(17)14(19)13(18)11(9)16/h8,20H,2,4-6H2,1,3H3 |
| InChIKey | PAJIEDHVDUGDHU-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|