C13H16F5N — CID 115782628
N-ethyl-3-methyl-1-(2,3,4,5,6-pentafluorophenyl)butan-1-amine (PubChem CID 115782628) has the molecular formula C13H16F5N and a molecular weight of 281.27 g/mol. Its IUPAC name is N-ethyl-3-methyl-1-(2,3,4,5,6-pentafluorophenyl)butan-1-amine.
| Compound Name | N-ethyl-3-methyl-1-(2,3,4,5,6-pentafluorophenyl)butan-1-amine |
|---|---|
| PubChem CID | 115782628 |
| Molecular Formula | C13H16F5N |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | N-ethyl-3-methyl-1-(2,3,4,5,6-pentafluorophenyl)butan-1-amine |
| SMILES | CCNC(CC(C)C)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H16F5N/c1-4-19-7(5-6(2)3)8-9(14)11(16)13(18)12(17)10(8)15/h6-7,19H,4-5H2,1-3H3 |
| InChIKey | NDULNBFFZYDHQC-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|