C15H19F4N — CID 114475641
N-ethyl-1-[5-fluoro-2-(trifluoromethyl)phenyl]-4-methylpent-4-en-1-amine (PubChem CID 114475641) has the molecular formula C15H19F4N and a molecular weight of 289.32 g/mol. Its IUPAC name is N-ethyl-1-[5-fluoro-2-(trifluoromethyl)phenyl]-4-methylpent-4-en-1-amine.
| Compound Name | N-ethyl-1-[5-fluoro-2-(trifluoromethyl)phenyl]-4-methylpent-4-en-1-amine |
|---|---|
| PubChem CID | 114475641 |
| Molecular Formula | C15H19F4N |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | N-ethyl-1-[5-fluoro-2-(trifluoromethyl)phenyl]-4-methylpent-4-en-1-amine |
| SMILES | C=C(C)CCC(NCC)c1cc(F)ccc1C(F)(F)F |
| InChI | InChI=1S/C15H19F4N/c1-4-20-14(8-5-10(2)3)12-9-11(16)6-7-13(12)15(17,18)19/h6-7,9,14,20H,2,4-5,8H2,1,3H3 |
| InChIKey | FQIVUVDPSVLGEJ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|