C12H16N2 — CID 105077584
N-ethyl-1-(2-methyl-3-pyridinyl)but-3-yn-1-amine (PubChem CID 105077584) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is N-ethyl-1-(2-methyl-3-pyridinyl)but-3-yn-1-amine.
| Compound Name | N-ethyl-1-(2-methyl-3-pyridinyl)but-3-yn-1-amine |
|---|---|
| PubChem CID | 105077584 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | N-ethyl-1-(2-methyl-3-pyridinyl)but-3-yn-1-amine |
| SMILES | C#CCC(NCC)c1cccnc1C |
| InChI | InChI=1S/C12H16N2/c1-4-7-12(13-5-2)11-8-6-9-14-10(11)3/h1,6,8-9,12-13H,5,7H2,2-3H3 |
| InChIKey | LRSDBQVJHRZDFU-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|