C18H22BrNO2S2 — CID 122392271
N-[1-(2-bromophenyl)sulfanyl-3-methylbutan-2-yl]-4-methylbenzenesulfonamide (PubChem CID 122392271) has the molecular formula C18H22BrNO2S2 and a molecular weight of 428.42 g/mol. Its IUPAC name is N-[1-(2-bromophenyl)sulfanyl-3-methylbutan-2-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[1-(2-bromophenyl)sulfanyl-3-methylbutan-2-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 122392271 |
| Molecular Formula | C18H22BrNO2S2 |
| Molecular Weight | 428.42 g/mol |
| Exact Mass | 427.03 |
| IUPAC Name | N-[1-(2-bromophenyl)sulfanyl-3-methylbutan-2-yl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(CSc2ccccc2Br)C(C)C)cc1 |
| InChI | InChI=1S/C18H22BrNO2S2/c1-13(2)17(12-23-18-7-5-4-6-16(18)19)20-24(21,22)15-10-8-14(3)9-11-15/h4-11,13,17,20H,12H2,1-3H3 |
| InChIKey | DPNRDRUIZNMVOM-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.42 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |