C24H25NO4S2 — CID 23446079
2-benzyl-3-[(4-methylphenyl)sulfonylamino]-4-phenylsulfanylbutanoic acid (PubChem CID 23446079) has the molecular formula C24H25NO4S2 and a molecular weight of 455.60 g/mol. Its IUPAC name is 2-benzyl-3-[(4-methylphenyl)sulfonylamino]-4-phenylsulfanylbutanoic acid.
| Compound Name | 2-benzyl-3-[(4-methylphenyl)sulfonylamino]-4-phenylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 23446079 |
| Molecular Formula | C24H25NO4S2 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | 2-benzyl-3-[(4-methylphenyl)sulfonylamino]-4-phenylsulfanylbutanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)NC(CSc2ccccc2)C(Cc2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C24H25NO4S2/c1-18-12-14-21(15-13-18)31(28,29)25-23(17-30-20-10-6-3-7-11-20)22(24(26)27)16-19-8-4-2-5-9-19/h2-15,22-23,25H,16-17H2,1H3,(H,26,27) |
| InChIKey | WHJRQGNVTWANDU-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |