C15H24N2O5S — CID 139017531
ethyl 3-[[3-(dimethylamino)-4-methylphenyl]sulfonylamino]-2-hydroxybutanoate (PubChem CID 139017531) has the molecular formula C15H24N2O5S and a molecular weight of 344.43 g/mol. Its IUPAC name is ethyl 3-[[3-(dimethylamino)-4-methylphenyl]sulfonylamino]-2-hydroxybutanoate.
| Compound Name | ethyl 3-[[3-(dimethylamino)-4-methylphenyl]sulfonylamino]-2-hydroxybutanoate |
|---|---|
| PubChem CID | 139017531 |
| Molecular Formula | C15H24N2O5S |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | ethyl 3-[[3-(dimethylamino)-4-methylphenyl]sulfonylamino]-2-hydroxybutanoate |
| SMILES | CCOC(=O)C(O)C(C)NS(=O)(=O)c1ccc(C)c(N(C)C)c1 |
| InChI | InChI=1S/C15H24N2O5S/c1-6-22-15(19)14(18)11(3)16-23(20,21)12-8-7-10(2)13(9-12)17(4)5/h7-9,11,14,16,18H,6H2,1-5H3 |
| InChIKey | NZNOJHCSOGYQJH-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |