C22H20ClN3O3 — CID 67780916
[2-[(4-chlorophenyl)carbamoylamino]-1,2-diphenylethyl]carbamic acid (PubChem CID 67780916) has the molecular formula C22H20ClN3O3 and a molecular weight of 409.87 g/mol. Its IUPAC name is [2-[(4-chlorophenyl)carbamoylamino]-1,2-diphenylethyl]carbamic acid.
| Compound Name | [2-[(4-chlorophenyl)carbamoylamino]-1,2-diphenylethyl]carbamic acid |
|---|---|
| PubChem CID | 67780916 |
| Molecular Formula | C22H20ClN3O3 |
| Molecular Weight | 409.87 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | [2-[(4-chlorophenyl)carbamoylamino]-1,2-diphenylethyl]carbamic acid |
| SMILES | O=C(O)NC(c1ccccc1)C(NC(=O)Nc1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H20ClN3O3/c23-17-11-13-18(14-12-17)24-21(27)25-19(15-7-3-1-4-8-15)20(26-22(28)29)16-9-5-2-6-10-16/h1-14,19-20,26H,(H,28,29)(H2,24,25,27) |
| InChIKey | QSDQSKYFDWFNJA-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.87 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |