C19H18F3N3O4 — CID 8887195
[2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] (2S)-2-(phenylcarbamoylamino)propanoate (PubChem CID 8887195) has the molecular formula C19H18F3N3O4 and a molecular weight of 409.36 g/mol. Its IUPAC name is [2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] (2S)-2-(phenylcarbamoylamino)propanoate.
| Compound Name | [2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] (2S)-2-(phenylcarbamoylamino)propanoate |
|---|---|
| PubChem CID | 8887195 |
| Molecular Formula | C19H18F3N3O4 |
| Molecular Weight | 409.36 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | [2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] (2S)-2-(phenylcarbamoylamino)propanoate |
| SMILES | C[C@H](NC(=O)Nc1ccccc1)C(=O)OCC(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H18F3N3O4/c1-12(23-18(28)25-14-5-3-2-4-6-14)17(27)29-11-16(26)24-15-9-7-13(8-10-15)19(20,21)22/h2-10,12H,11H2,1H3,(H,24,26)(H2,23,25,28)/t12-/m0/s1 |
| InChIKey | SGGYTMIVSWVKBP-LBPRGKRZSA-N |
| XLogP | 3.40 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.36 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |