C20H22N4O5 — CID 8887345
[2-(3-acetamidoanilino)-2-oxoethyl] (2S)-2-(phenylcarbamoylamino)propanoate (PubChem CID 8887345) has the molecular formula C20H22N4O5 and a molecular weight of 398.42 g/mol. Its IUPAC name is [2-(3-acetamidoanilino)-2-oxoethyl] (2S)-2-(phenylcarbamoylamino)propanoate.
| Compound Name | [2-(3-acetamidoanilino)-2-oxoethyl] (2S)-2-(phenylcarbamoylamino)propanoate |
|---|---|
| PubChem CID | 8887345 |
| Molecular Formula | C20H22N4O5 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | [2-(3-acetamidoanilino)-2-oxoethyl] (2S)-2-(phenylcarbamoylamino)propanoate |
| SMILES | CC(=O)Nc1cccc(NC(=O)COC(=O)[C@H](C)NC(=O)Nc2ccccc2)c1 |
| InChI | InChI=1S/C20H22N4O5/c1-13(21-20(28)24-15-7-4-3-5-8-15)19(27)29-12-18(26)23-17-10-6-9-16(11-17)22-14(2)25/h3-11,13H,12H2,1-2H3,(H,22,25)(H,23,26)(H2,21,24,28)/t13-/m0/s1 |
| InChIKey | YRKIJBNHPFVAKR-ZDUSSCGKSA-N |
| XLogP | 2.34 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |