C19H20ClN3O4 — CID 8887138
[2-(3-chloro-4-methylanilino)-2-oxoethyl] (2S)-2-(phenylcarbamoylamino)propanoate (PubChem CID 8887138) has the molecular formula C19H20ClN3O4 and a molecular weight of 389.84 g/mol. Its IUPAC name is [2-(3-chloro-4-methylanilino)-2-oxoethyl] (2S)-2-(phenylcarbamoylamino)propanoate.
| Compound Name | [2-(3-chloro-4-methylanilino)-2-oxoethyl] (2S)-2-(phenylcarbamoylamino)propanoate |
|---|---|
| PubChem CID | 8887138 |
| Molecular Formula | C19H20ClN3O4 |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | [2-(3-chloro-4-methylanilino)-2-oxoethyl] (2S)-2-(phenylcarbamoylamino)propanoate |
| SMILES | Cc1ccc(NC(=O)COC(=O)[C@H](C)NC(=O)Nc2ccccc2)cc1Cl |
| InChI | InChI=1S/C19H20ClN3O4/c1-12-8-9-15(10-16(12)20)22-17(24)11-27-18(25)13(2)21-19(26)23-14-6-4-3-5-7-14/h3-10,13H,11H2,1-2H3,(H,22,24)(H2,21,23,26)/t13-/m0/s1 |
| InChIKey | LEYLHXRAHYVVHU-ZDUSSCGKSA-N |
| XLogP | 3.34 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |