C23H20ClNO4 — CID 7191563
[2-(3-chloro-4-methylanilino)-2-oxoethyl] 2-hydroxy-2,2-diphenylacetate (PubChem CID 7191563) has the molecular formula C23H20ClNO4 and a molecular weight of 409.87 g/mol. Its IUPAC name is [2-(3-chloro-4-methylanilino)-2-oxoethyl] 2-hydroxy-2,2-diphenylacetate.
| Compound Name | [2-(3-chloro-4-methylanilino)-2-oxoethyl] 2-hydroxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 7191563 |
| Molecular Formula | C23H20ClNO4 |
| Molecular Weight | 409.87 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | [2-(3-chloro-4-methylanilino)-2-oxoethyl] 2-hydroxy-2,2-diphenylacetate |
| SMILES | Cc1ccc(NC(=O)COC(=O)C(O)(c2ccccc2)c2ccccc2)cc1Cl |
| InChI | InChI=1S/C23H20ClNO4/c1-16-12-13-19(14-20(16)24)25-21(26)15-29-22(27)23(28,17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-14,28H,15H2,1H3,(H,25,26) |
| InChIKey | CIRVVFNEHSCLQS-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.87 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |