C20H26N2 — CID 170788082
(1R,2R)-N'-cyclohexyl-1,2-diphenylethane-1,2-diamine (PubChem CID 170788082) has the molecular formula C20H26N2 and a molecular weight of 294.44 g/mol. Its IUPAC name is (1R,2R)-N'-cyclohexyl-1,2-diphenylethane-1,2-diamine.
| Compound Name | (1R,2R)-N'-cyclohexyl-1,2-diphenylethane-1,2-diamine |
|---|---|
| PubChem CID | 170788082 |
| Molecular Formula | C20H26N2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | (1R,2R)-N'-cyclohexyl-1,2-diphenylethane-1,2-diamine |
| SMILES | N[C@H](c1ccccc1)[C@H](NC1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C20H26N2/c21-19(16-10-4-1-5-11-16)20(17-12-6-2-7-13-17)22-18-14-8-3-9-15-18/h1-2,4-7,10-13,18-20,22H,3,8-9,14-15,21H2/t19-,20-/m1/s1 |
| InChIKey | DUPVDVXVJWKNRZ-WOJBJXKFSA-N |
| XLogP | 4.35 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |