C19H24N2O — CID 15247406
(1R,2R)-2-(cyclohexylamino)-1-phenyl-2-pyridin-3-ylethanol (PubChem CID 15247406) has the molecular formula C19H24N2O and a molecular weight of 296.41 g/mol. Its IUPAC name is (1R,2R)-2-(cyclohexylamino)-1-phenyl-2-pyridin-3-ylethanol.
| Compound Name | (1R,2R)-2-(cyclohexylamino)-1-phenyl-2-pyridin-3-ylethanol |
|---|---|
| PubChem CID | 15247406 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | (1R,2R)-2-(cyclohexylamino)-1-phenyl-2-pyridin-3-ylethanol |
| SMILES | O[C@H](c1ccccc1)[C@H](NC1CCCCC1)c1cccnc1 |
| InChI | InChI=1S/C19H24N2O/c22-19(15-8-3-1-4-9-15)18(16-10-7-13-20-14-16)21-17-11-5-2-6-12-17/h1,3-4,7-10,13-14,17-19,21-22H,2,5-6,11-12H2/t18-,19-/m1/s1 |
| InChIKey | AHJGPFWDCOWLGA-RTBURBONSA-N |
| XLogP | 3.78 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |