(2R)-2-(cyclopentylamino)-2-pyridin-3-ylacetic acid

C12H16N2O2 — CID 93412375

IUPAC(2R)-2-(cyclopentylamino)-2-pyridin-3-ylacetic acid
SMILESO=C(O)[C@H](NC1CCCC1)c1cccnc1
InChIInChI=1S/C12H16N2O2/c15-12(16)11(9-4-3-7-13-8-9)14-10-5-1-2-6-10/h3-4,7-8,10-11,14H,1-2,5-6H2,(H,15,16)/t11-/m1/s1
InChIKeyDOHKXCPILBOGCB-LLVKDONJSA-N
MW220.27 g/mol
LogP1.74
Rot. Bonds4

About (2R)-2-(cyclopentylamino)-2-pyridin-3-ylacetic acid

(2R)-2-(cyclopentylamino)-2-pyridin-3-ylacetic acid (PubChem CID 93412375) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is (2R)-2-(cyclopentylamino)-2-pyridin-3-ylacetic acid.

Molecular Properties

Compound Name(2R)-2-(cyclopentylamino)-2-pyridin-3-ylacetic acid
PubChem CID93412375
Molecular FormulaC12H16N2O2
Molecular Weight220.27 g/mol
Exact Mass220.12
IUPAC Name(2R)-2-(cyclopentylamino)-2-pyridin-3-ylacetic acid
SMILESO=C(O)[C@H](NC1CCCC1)c1cccnc1
InChIInChI=1S/C12H16N2O2/c15-12(16)11(9-4-3-7-13-8-9)14-10-5-1-2-6-10/h3-4,7-8,10-11,14H,1-2,5-6H2,(H,15,16)/t11-/m1/s1
InChIKeyDOHKXCPILBOGCB-LLVKDONJSA-N
XLogP1.74
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500220.27
LogP ≤ 51.74
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze (2R)-2-(cyclopentylamino)-2-pyridin-3-ylacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(2R)-2-(cyclopropylamino)-2-pyridin-3-ylacetic acid
CID 93280695
3-(cyclohexylamino)-3-oxo-2-pyridin-3-ylpropanoic acid
CID 91593351
methyl 2-(cyclopropylamino)-2-pyridin-3-ylacetate
CID 60795276
(1R,2R)-2-(cyclohexylamino)-1-phenyl-2-pyridin-3-ylethanol
CID 15247406
2-(cyclohexylamino)-2-(3-methoxyphenyl)acetic acid
CID 54892787
N-[(1S)-1-pyridin-3-ylethyl]cycloheptanamine
CID 28646604
N-(1-pyridin-3-ylethyl)cyclododecanamine
CID 43079395
2-(4-chlorophenyl)-2-(cyclopentylamino)acetic acid
CID 54894372
2-[(4-methylcycloheptyl)amino]-2-phenylacetic acid
CID 65080241
2-(cyclopentylamino)-2-[3-(trifluoromethyl)phenyl]acetic acid
CID 60997313
2-(propanoylamino)-2-pyridin-3-ylacetic acid
CID 82077606
methyl (2S)-2-cyclopentyl-2-pyridin-3-ylacetate
CID 129395618

Frequently Asked Questions

What is the IUPAC name of (2R)-2-(cyclopentylamino)-2-pyridin-3-ylacetic acid?
The IUPAC name of (2R)-2-(cyclopentylamino)-2-pyridin-3-ylacetic acid (CID 93412375) is (2R)-2-(cyclopentylamino)-2-pyridin-3-ylacetic acid.
What is the SMILES notation for (2R)-2-(cyclopentylamino)-2-pyridin-3-ylacetic acid?
The canonical SMILES for (2R)-2-(cyclopentylamino)-2-pyridin-3-ylacetic acid is O=C(O)[C@H](NC1CCCC1)c1cccnc1.
What is the InChIKey of (2R)-2-(cyclopentylamino)-2-pyridin-3-ylacetic acid?
The InChIKey is DOHKXCPILBOGCB-LLVKDONJSA-N. The full InChI is InChI=1S/C12H16N2O2/c15-12(16)11(9-4-3-7-13-8-9)14-10-5-1-2-6-10/h3-4,7-8,10-11,14H,1-2,5-6H2,(H,15,16)/t11-/m1/s1.
What are the key properties of (2R)-2-(cyclopentylamino)-2-pyridin-3-ylacetic acid?
(2R)-2-(cyclopentylamino)-2-pyridin-3-ylacetic acid has a molecular weight of 220.27 g/mol, XLogP of 1.74, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(cyclopentylamino)-2-pyridin-3-ylacetic acid is sourced from PubChem (CID 93412375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).