C16H26N2O4 — CID 70268415
2-amino-4-methylhex-4-enoic acid;(1S,2S)-2-amino-1-phenylpropane-1,3-diol (PubChem CID 70268415) has the molecular formula C16H26N2O4 and a molecular weight of 310.39 g/mol. Its IUPAC name is 2-amino-4-methylhex-4-enoic acid;(1S,2S)-2-amino-1-phenylpropane-1,3-diol.
| Compound Name | 2-amino-4-methylhex-4-enoic acid;(1S,2S)-2-amino-1-phenylpropane-1,3-diol |
|---|---|
| PubChem CID | 70268415 |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 2-amino-4-methylhex-4-enoic acid;(1S,2S)-2-amino-1-phenylpropane-1,3-diol |
| SMILES | CC=C(C)CC(N)C(=O)O.N[C@@H](CO)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C9H13NO2.C7H13NO2/c10-8(6-11)9(12)7-4-2-1-3-5-7;1-3-5(2)4-6(8)7(9)10/h1-5,8-9,11-12H,6,10H2;3,6H,4,8H2,1-2H3,(H,9,10)/t8-,9-;/m0./s1 |
| InChIKey | GRQXPANXCFBZQD-OZZZDHQUSA-N |
| XLogP | 0.79 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|