C23H23NO3S — CID 8907250
(2R)-N-(2-ethoxyphenyl)-2-(4-methoxyphenyl)sulfanyl-2-phenylacetamide (PubChem CID 8907250) has the molecular formula C23H23NO3S and a molecular weight of 393.51 g/mol. Its IUPAC name is (2R)-N-(2-ethoxyphenyl)-2-(4-methoxyphenyl)sulfanyl-2-phenylacetamide.
| Compound Name | (2R)-N-(2-ethoxyphenyl)-2-(4-methoxyphenyl)sulfanyl-2-phenylacetamide |
|---|---|
| PubChem CID | 8907250 |
| Molecular Formula | C23H23NO3S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | (2R)-N-(2-ethoxyphenyl)-2-(4-methoxyphenyl)sulfanyl-2-phenylacetamide |
| SMILES | CCOc1ccccc1NC(=O)[C@H](Sc1ccc(OC)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H23NO3S/c1-3-27-21-12-8-7-11-20(21)24-23(25)22(17-9-5-4-6-10-17)28-19-15-13-18(26-2)14-16-19/h4-16,22H,3H2,1-2H3,(H,24,25)/t22-/m1/s1 |
| InChIKey | DTRDUKABWOPPRX-JOCHJYFZSA-N |
| XLogP | 5.57 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |