C30H28N2O4S — CID 19059621
2-[4-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]sulfanyl-N-(2-ethoxyphenyl)-2-phenylacetamide (PubChem CID 19059621) has the molecular formula C30H28N2O4S and a molecular weight of 512.63 g/mol. Its IUPAC name is 2-[4-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]sulfanyl-N-(2-ethoxyphenyl)-2-phenylacetamide.
| Compound Name | 2-[4-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]sulfanyl-N-(2-ethoxyphenyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 19059621 |
| Molecular Formula | C30H28N2O4S |
| Molecular Weight | 512.63 g/mol |
| Exact Mass | 512.18 |
| IUPAC Name | 2-[4-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)phenyl]sulfanyl-N-(2-ethoxyphenyl)-2-phenylacetamide |
| SMILES | CCOc1ccccc1NC(=O)C(Sc1ccc(N2C(=O)C3CC=CCC3C2=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C30H28N2O4S/c1-2-36-26-15-9-8-14-25(26)31-28(33)27(20-10-4-3-5-11-20)37-22-18-16-21(17-19-22)32-29(34)23-12-6-7-13-24(23)30(32)35/h3-11,14-19,23-24,27H,2,12-13H2,1H3,(H,31,33) |
| InChIKey | DKXYYOFFNUSVRI-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.63 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|