C30H26N2O4S — CID 99130133
(2R)-2-[4-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl]sulfanyl-N-(4-acetylphenyl)-2-phenylacetamide (PubChem CID 99130133) has the molecular formula C30H26N2O4S and a molecular weight of 510.62 g/mol. Its IUPAC name is (2R)-2-[4-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl]sulfanyl-N-(4-acetylphenyl)-2-phenylacetamide.
| Compound Name | (2R)-2-[4-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl]sulfanyl-N-(4-acetylphenyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 99130133 |
| Molecular Formula | C30H26N2O4S |
| Molecular Weight | 510.62 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | (2R)-2-[4-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl]sulfanyl-N-(4-acetylphenyl)-2-phenylacetamide |
| SMILES | CC(=O)c1ccc(NC(=O)[C@H](Sc2ccc(N3C(=O)[C@H]4CC=CC[C@H]4C3=O)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H26N2O4S/c1-19(33)20-11-13-22(14-12-20)31-28(34)27(21-7-3-2-4-8-21)37-24-17-15-23(16-18-24)32-29(35)25-9-5-6-10-26(25)30(32)36/h2-8,11-18,25-27H,9-10H2,1H3,(H,31,34)/t25-,26+,27-/m1/s1 |
| InChIKey | MNUKWRJGTQDSSK-KWXIBIRDSA-N |
| XLogP | 5.82 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.62 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|