C30H30N2O4S — CID 22785773
6-[[4-[2-(3,5-dimethylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 22785773) has the molecular formula C30H30N2O4S and a molecular weight of 514.65 g/mol. Its IUPAC name is 6-[[4-[2-(3,5-dimethylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-[[4-[2-(3,5-dimethylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 22785773 |
| Molecular Formula | C30H30N2O4S |
| Molecular Weight | 514.65 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | 6-[[4-[2-(3,5-dimethylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | Cc1cc(C)cc(NC(=O)C(Sc2ccc(NC(=O)C3CC=CCC3C(=O)O)cc2)c2ccccc2)c1 |
| InChI | InChI=1S/C30H30N2O4S/c1-19-16-20(2)18-23(17-19)32-29(34)27(21-8-4-3-5-9-21)37-24-14-12-22(13-15-24)31-28(33)25-10-6-7-11-26(25)30(35)36/h3-9,12-18,25-27H,10-11H2,1-2H3,(H,31,33)(H,32,34)(H,35,36) |
| InChIKey | GBHUGMAZPQHRNO-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.65 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|