C30H29ClN2O6S — CID 22785784
6-[[4-[2-(5-chloro-2,4-dimethoxyanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 22785784) has the molecular formula C30H29ClN2O6S and a molecular weight of 581.09 g/mol. Its IUPAC name is 6-[[4-[2-(5-chloro-2,4-dimethoxyanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-[[4-[2-(5-chloro-2,4-dimethoxyanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 22785784 |
| Molecular Formula | C30H29ClN2O6S |
| Molecular Weight | 581.09 g/mol |
| Exact Mass | 580.14 |
| IUPAC Name | 6-[[4-[2-(5-chloro-2,4-dimethoxyanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | COc1cc(OC)c(NC(=O)C(Sc2ccc(NC(=O)C3CC=CCC3C(=O)O)cc2)c2ccccc2)cc1Cl |
| InChI | InChI=1S/C30H29ClN2O6S/c1-38-25-17-26(39-2)24(16-23(25)31)33-29(35)27(18-8-4-3-5-9-18)40-20-14-12-19(13-15-20)32-28(34)21-10-6-7-11-22(21)30(36)37/h3-9,12-17,21-22,27H,10-11H2,1-2H3,(H,32,34)(H,33,35)(H,36,37) |
| InChIKey | WXXABIJUGMYLLB-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.09 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|