C29H27ClN2O4S — CID 18896344
6-[[3-[2-(3-chloro-2-methylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 18896344) has the molecular formula C29H27ClN2O4S and a molecular weight of 535.07 g/mol. Its IUPAC name is 6-[[3-[2-(3-chloro-2-methylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-[[3-[2-(3-chloro-2-methylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 18896344 |
| Molecular Formula | C29H27ClN2O4S |
| Molecular Weight | 535.07 g/mol |
| Exact Mass | 534.14 |
| IUPAC Name | 6-[[3-[2-(3-chloro-2-methylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | Cc1c(Cl)cccc1NC(=O)C(Sc1cccc(NC(=O)C2CC=CCC2C(=O)O)c1)c1ccccc1 |
| InChI | InChI=1S/C29H27ClN2O4S/c1-18-24(30)15-8-16-25(18)32-28(34)26(19-9-3-2-4-10-19)37-21-12-7-11-20(17-21)31-27(33)22-13-5-6-14-23(22)29(35)36/h2-12,15-17,22-23,26H,13-14H2,1H3,(H,31,33)(H,32,34)(H,35,36) |
| InChIKey | NFAFAACYAJQNPU-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.07 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|