C29H27N3O5S — CID 18896399
6-[[3-[2-(2-carbamoylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 18896399) has the molecular formula C29H27N3O5S and a molecular weight of 529.62 g/mol. Its IUPAC name is 6-[[3-[2-(2-carbamoylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-[[3-[2-(2-carbamoylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 18896399 |
| Molecular Formula | C29H27N3O5S |
| Molecular Weight | 529.62 g/mol |
| Exact Mass | 529.17 |
| IUPAC Name | 6-[[3-[2-(2-carbamoylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | NC(=O)c1ccccc1NC(=O)C(Sc1cccc(NC(=O)C2CC=CCC2C(=O)O)c1)c1ccccc1 |
| InChI | InChI=1S/C29H27N3O5S/c30-26(33)23-15-6-7-16-24(23)32-28(35)25(18-9-2-1-3-10-18)38-20-12-8-11-19(17-20)31-27(34)21-13-4-5-14-22(21)29(36)37/h1-12,15-17,21-22,25H,13-14H2,(H2,30,33)(H,31,34)(H,32,35)(H,36,37) |
| InChIKey | MKLKAVKNQACBTN-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.62 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|