C28H29N3O3S — CID 18907835
2-[[2-[3-(cyclohexanecarbonylamino)phenyl]sulfanyl-2-phenylacetyl]amino]benzamide (PubChem CID 18907835) has the molecular formula C28H29N3O3S and a molecular weight of 487.63 g/mol. Its IUPAC name is 2-[[2-[3-(cyclohexanecarbonylamino)phenyl]sulfanyl-2-phenylacetyl]amino]benzamide.
| Compound Name | 2-[[2-[3-(cyclohexanecarbonylamino)phenyl]sulfanyl-2-phenylacetyl]amino]benzamide |
|---|---|
| PubChem CID | 18907835 |
| Molecular Formula | C28H29N3O3S |
| Molecular Weight | 487.63 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | 2-[[2-[3-(cyclohexanecarbonylamino)phenyl]sulfanyl-2-phenylacetyl]amino]benzamide |
| SMILES | NC(=O)c1ccccc1NC(=O)C(Sc1cccc(NC(=O)C2CCCCC2)c1)c1ccccc1 |
| InChI | InChI=1S/C28H29N3O3S/c29-26(32)23-16-7-8-17-24(23)31-28(34)25(19-10-3-1-4-11-19)35-22-15-9-14-21(18-22)30-27(33)20-12-5-2-6-13-20/h1,3-4,7-11,14-18,20,25H,2,5-6,12-13H2,(H2,29,32)(H,30,33)(H,31,34) |
| InChIKey | IZFVJPLCYGJPBB-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.63 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |