C24H28N2O4S — CID 18907601
methyl 2-[2-[3-(cyclohexanecarbonylamino)phenyl]sulfanylpropanoylamino]benzoate (PubChem CID 18907601) has the molecular formula C24H28N2O4S and a molecular weight of 440.57 g/mol. Its IUPAC name is methyl 2-[2-[3-(cyclohexanecarbonylamino)phenyl]sulfanylpropanoylamino]benzoate.
| Compound Name | methyl 2-[2-[3-(cyclohexanecarbonylamino)phenyl]sulfanylpropanoylamino]benzoate |
|---|---|
| PubChem CID | 18907601 |
| Molecular Formula | C24H28N2O4S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | methyl 2-[2-[3-(cyclohexanecarbonylamino)phenyl]sulfanylpropanoylamino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)C(C)Sc1cccc(NC(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C24H28N2O4S/c1-16(22(27)26-21-14-7-6-13-20(21)24(29)30-2)31-19-12-8-11-18(15-19)25-23(28)17-9-4-3-5-10-17/h6-8,11-17H,3-5,9-10H2,1-2H3,(H,25,28)(H,26,27) |
| InChIKey | XUXCERGAKRNOSC-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |