C25H18Cl4N2O6S — CID 18895877
2,3,4,5-tetrachloro-6-[[3-[1-(2-methoxycarbonylanilino)-1-oxopropan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid (PubChem CID 18895877) has the molecular formula C25H18Cl4N2O6S and a molecular weight of 616.31 g/mol. Its IUPAC name is 2,3,4,5-tetrachloro-6-[[3-[1-(2-methoxycarbonylanilino)-1-oxopropan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid.
| Compound Name | 2,3,4,5-tetrachloro-6-[[3-[1-(2-methoxycarbonylanilino)-1-oxopropan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 18895877 |
| Molecular Formula | C25H18Cl4N2O6S |
| Molecular Weight | 616.31 g/mol |
| Exact Mass | 613.96 |
| IUPAC Name | 2,3,4,5-tetrachloro-6-[[3-[1-(2-methoxycarbonylanilino)-1-oxopropan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid |
| SMILES | COC(=O)c1ccccc1NC(=O)C(C)Sc1cccc(NC(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c2C(=O)O)c1 |
| InChI | InChI=1S/C25H18Cl4N2O6S/c1-11(22(32)31-15-9-4-3-8-14(15)25(36)37-2)38-13-7-5-6-12(10-13)30-23(33)16-17(24(34)35)19(27)21(29)20(28)18(16)26/h3-11H,1-2H3,(H,30,33)(H,31,32)(H,34,35) |
| InChIKey | ZTBVESBFBNJUBD-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.31 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|