C20H20N2O4S — CID 18901275
3-[2-[3-(cyclopropanecarbonylamino)phenyl]sulfanylpropanoylamino]benzoic acid (PubChem CID 18901275) has the molecular formula C20H20N2O4S and a molecular weight of 384.46 g/mol. Its IUPAC name is 3-[2-[3-(cyclopropanecarbonylamino)phenyl]sulfanylpropanoylamino]benzoic acid.
| Compound Name | 3-[2-[3-(cyclopropanecarbonylamino)phenyl]sulfanylpropanoylamino]benzoic acid |
|---|---|
| PubChem CID | 18901275 |
| Molecular Formula | C20H20N2O4S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 3-[2-[3-(cyclopropanecarbonylamino)phenyl]sulfanylpropanoylamino]benzoic acid |
| SMILES | CC(Sc1cccc(NC(=O)C2CC2)c1)C(=O)Nc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C20H20N2O4S/c1-12(18(23)21-15-5-2-4-14(10-15)20(25)26)27-17-7-3-6-16(11-17)22-19(24)13-8-9-13/h2-7,10-13H,8-9H2,1H3,(H,21,23)(H,22,24)(H,25,26) |
| InChIKey | FXZNKYVLNOXPHL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |